C17H30F3NO3 — CID 91727809
nonyl 4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 91727809) has the molecular formula C17H30F3NO3 and a molecular weight of 353.43 g/mol. Its IUPAC name is nonyl 4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | nonyl 4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 91727809 |
| Molecular Formula | C17H30F3NO3 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | nonyl 4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CCCCCCCCCOC(=O)C(CC(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H30F3NO3/c1-4-5-6-7-8-9-10-11-24-15(22)14(12-13(2)3)21-16(23)17(18,19)20/h13-14H,4-12H2,1-3H3,(H,21,23) |
| InChIKey | GLAZERMGWFMWCN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|