C14H20F6N2O4 — CID 527830
butyl 2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 527830) has the molecular formula C14H20F6N2O4 and a molecular weight of 394.31 g/mol. Its IUPAC name is butyl 2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | butyl 2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 527830 |
| Molecular Formula | C14H20F6N2O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | butyl 2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | CCCCOC(=O)C(CCCCNC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H20F6N2O4/c1-2-3-8-26-10(23)9(22-12(25)14(18,19)20)6-4-5-7-21-11(24)13(15,16)17/h9H,2-8H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | TYLLSQHVLXVPTR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|