methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate

C10H16F3NO3 — CID 90995953

IUPACmethyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate
SMILESCCCCCC(NC(=O)C(F)(F)F)C(=O)OC
InChIInChI=1S/C10H16F3NO3/c1-3-4-5-6-7(8(15)17-2)14-9(16)10(11,12)13/h7H,3-6H2,1-2H3,(H,14,16)
InChIKeyWOPXIEJLDUCFAL-UHFFFAOYSA-N
MW255.24 g/mol
LogP1.79
Rot. Bonds6

About methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate

methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate (PubChem CID 90995953) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate.

Molecular Properties

Compound Namemethyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate
PubChem CID90995953
Molecular FormulaC10H16F3NO3
Molecular Weight255.24 g/mol
Exact Mass255.11
IUPAC Namemethyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate
SMILESCCCCCC(NC(=O)C(F)(F)F)C(=O)OC
InChIInChI=1S/C10H16F3NO3/c1-3-4-5-6-7(8(15)17-2)14-9(16)10(11,12)13/h7H,3-6H2,1-2H3,(H,14,16)
InChIKeyWOPXIEJLDUCFAL-UHFFFAOYSA-N
XLogP1.79
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.24
LogP ≤ 51.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate?
The IUPAC name of methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate (CID 90995953) is methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate.
What is the SMILES notation for methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate?
The canonical SMILES for methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate is CCCCCC(NC(=O)C(F)(F)F)C(=O)OC.
What is the InChIKey of methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate?
The InChIKey is WOPXIEJLDUCFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO3/c1-3-4-5-6-7(8(15)17-2)14-9(16)10(11,12)13/h7H,3-6H2,1-2H3,(H,14,16).
What are the key properties of methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate?
methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate has a molecular weight of 255.24 g/mol, XLogP of 1.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate is sourced from PubChem (CID 90995953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).