C10H16F3NO3 — CID 90995953
methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate (PubChem CID 90995953) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate.
| Compound Name | methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate |
|---|---|
| PubChem CID | 90995953 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | methyl 2-[(2,2,2-trifluoroacetyl)amino]heptanoate |
| SMILES | CCCCCC(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C10H16F3NO3/c1-3-4-5-6-7(8(15)17-2)14-9(16)10(11,12)13/h7H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | WOPXIEJLDUCFAL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|