About methyl 2-acetamidooctanoate
methyl 2-acetamidooctanoate (PubChem CID 6429509) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 2-acetamidooctanoate.
Molecular Properties
| Compound Name | methyl 2-acetamidooctanoate |
| PubChem CID | 6429509 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl 2-acetamidooctanoate |
| SMILES | CCCCCCC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C11H21NO3/c1-4-5-6-7-8-10(11(14)15-3)12-9(2)13/h10H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | HXEHVYHMGGXHQE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetamidooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamidooctanoate?
The IUPAC name of methyl 2-acetamidooctanoate (CID 6429509) is methyl 2-acetamidooctanoate.
What is the SMILES notation for methyl 2-acetamidooctanoate?
The canonical SMILES for methyl 2-acetamidooctanoate is CCCCCCC(NC(C)=O)C(=O)OC.
What is the InChIKey of methyl 2-acetamidooctanoate?
The InChIKey is HXEHVYHMGGXHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-4-5-6-7-8-10(11(14)15-3)12-9(2)13/h10H,4-8H2,1-3H3,(H,12,13).
What are the key properties of methyl 2-acetamidooctanoate?
methyl 2-acetamidooctanoate has a molecular weight of 215.29 g/mol, XLogP of 1.63, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamidooctanoate is sourced from PubChem (CID 6429509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).