C9H18N2O3+ — CID 157010257
CID 157010257 (PubChem CID 157010257) has the molecular formula C9H18N2O3+ and a molecular weight of 202.25 g/mol.
| Compound Name | CID 157010257 |
|---|---|
| PubChem CID | 157010257 |
| Molecular Formula | C9H18N2O3+ |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | — |
| SMILES | COC(=O)C(CCCC[NH2+])NC(C)=O |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)11-8(9(13)14-2)5-3-4-6-10/h8H,3-6,10H2,1-2H3,(H,11,12)/q+1 |
| InChIKey | KLNKEBIGCFOGKQ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|