C16H26N2O9 — CID 10548423
dimethyl (2S)-2-[[(3S)-3-acetamido-4-methoxy-4-oxobutanoyl]amino]-6-hydroxyheptanedioate (PubChem CID 10548423) has the molecular formula C16H26N2O9 and a molecular weight of 390.39 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(3S)-3-acetamido-4-methoxy-4-oxobutanoyl]amino]-6-hydroxyheptanedioate.
| Compound Name | dimethyl (2S)-2-[[(3S)-3-acetamido-4-methoxy-4-oxobutanoyl]amino]-6-hydroxyheptanedioate |
|---|---|
| PubChem CID | 10548423 |
| Molecular Formula | C16H26N2O9 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | dimethyl (2S)-2-[[(3S)-3-acetamido-4-methoxy-4-oxobutanoyl]amino]-6-hydroxyheptanedioate |
| SMILES | COC(=O)C(O)CCC[C@H](NC(=O)C[C@H](NC(C)=O)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H26N2O9/c1-9(19)17-11(15(23)26-3)8-13(21)18-10(14(22)25-2)6-5-7-12(20)16(24)27-4/h10-12,20H,5-8H2,1-4H3,(H,17,19)(H,18,21)/t10-,11-,12?/m0/s1 |
| InChIKey | QCEZMWRDUTYLJU-NDQFZYFBSA-N |
| XLogP | -1.58 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|