About dimethyl 2-acetamidononanedioate
dimethyl 2-acetamidononanedioate (PubChem CID 71387450) has the molecular formula C13H23NO5
and a molecular weight of 273.33 g/mol. Its IUPAC name is dimethyl 2-acetamidononanedioate.
Molecular Properties
| Compound Name | dimethyl 2-acetamidononanedioate |
| PubChem CID | 71387450 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | dimethyl 2-acetamidononanedioate |
| SMILES | COC(=O)CCCCCCC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C13H23NO5/c1-10(15)14-11(13(17)19-3)8-6-4-5-7-9-12(16)18-2/h11H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | SIYAQCLTDWRWAY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-acetamidononanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-acetamidononanedioate?
The IUPAC name of dimethyl 2-acetamidononanedioate (CID 71387450) is dimethyl 2-acetamidononanedioate.
What is the SMILES notation for dimethyl 2-acetamidononanedioate?
The canonical SMILES for dimethyl 2-acetamidononanedioate is COC(=O)CCCCCCC(NC(C)=O)C(=O)OC.
What is the InChIKey of dimethyl 2-acetamidononanedioate?
The InChIKey is SIYAQCLTDWRWAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO5/c1-10(15)14-11(13(17)19-3)8-6-4-5-7-9-12(16)18-2/h11H,4-9H2,1-3H3,(H,14,15).
What are the key properties of dimethyl 2-acetamidononanedioate?
dimethyl 2-acetamidononanedioate has a molecular weight of 273.33 g/mol, XLogP of 1.18, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-acetamidononanedioate is sourced from PubChem (CID 71387450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).