C12H19NO6 — CID 54470181
dimethyl 2-(4-oxopentanoylamino)pentanedioate (PubChem CID 54470181) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is dimethyl 2-(4-oxopentanoylamino)pentanedioate.
| Compound Name | dimethyl 2-(4-oxopentanoylamino)pentanedioate |
|---|---|
| PubChem CID | 54470181 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | dimethyl 2-(4-oxopentanoylamino)pentanedioate |
| SMILES | COC(=O)CCC(NC(=O)CCC(C)=O)C(=O)OC |
| InChI | InChI=1S/C12H19NO6/c1-8(14)4-6-10(15)13-9(12(17)19-3)5-7-11(16)18-2/h9H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | XHTYEUXTESSMLW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |