C13H21NO6 — CID 59384171
dimethyl (2S)-2-(5-oxohexanoylamino)pentanedioate (PubChem CID 59384171) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is dimethyl (2S)-2-(5-oxohexanoylamino)pentanedioate.
| Compound Name | dimethyl (2S)-2-(5-oxohexanoylamino)pentanedioate |
|---|---|
| PubChem CID | 59384171 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | dimethyl (2S)-2-(5-oxohexanoylamino)pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)CCCC(C)=O)C(=O)OC |
| InChI | InChI=1S/C13H21NO6/c1-9(15)5-4-6-11(16)14-10(13(18)20-3)7-8-12(17)19-2/h10H,4-8H2,1-3H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | ANTOFISSYILCMI-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |