C20H40N2O3 — CID 19368986
methyl 6-amino-2-(tridecanoylamino)hexanoate (PubChem CID 19368986) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is methyl 6-amino-2-(tridecanoylamino)hexanoate.
| Compound Name | methyl 6-amino-2-(tridecanoylamino)hexanoate |
|---|---|
| PubChem CID | 19368986 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | methyl 6-amino-2-(tridecanoylamino)hexanoate |
| SMILES | CCCCCCCCCCCCC(=O)NC(CCCCN)C(=O)OC |
| InChI | InChI=1S/C20H40N2O3/c1-3-4-5-6-7-8-9-10-11-12-16-19(23)22-18(20(24)25-2)15-13-14-17-21/h18H,3-17,21H2,1-2H3,(H,22,23) |
| InChIKey | STJITSZJAFEBSS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|