C15H22F3NO4S — CID 57124544
methyl 3-(4-hydroxynon-2-ynylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 57124544) has the molecular formula C15H22F3NO4S and a molecular weight of 369.41 g/mol. Its IUPAC name is methyl 3-(4-hydroxynon-2-ynylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl 3-(4-hydroxynon-2-ynylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 57124544 |
| Molecular Formula | C15H22F3NO4S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 3-(4-hydroxynon-2-ynylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CCCCCC(O)C#CCSCC(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C15H22F3NO4S/c1-3-4-5-7-11(20)8-6-9-24-10-12(13(21)23-2)19-14(22)15(16,17)18/h11-12,20H,3-5,7,9-10H2,1-2H3,(H,19,22) |
| InChIKey | JUCUKEHNISBDIQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|