About ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate
ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 58448718) has the molecular formula C7H10F3NO4
and a molecular weight of 229.15 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
Analyze ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The IUPAC name of ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CID 58448718) is ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
What is the SMILES notation for ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The canonical SMILES for ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate is CCOC(=O)C(CO)NC(=O)C(F)(F)F.
What is the InChIKey of ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The InChIKey is AUKYRADQPKFYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO4/c1-2-15-5(13)4(3-12)11-6(14)7(8,9)10/h4,12H,2-3H2,1H3,(H,11,14).
What are the key properties of ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate has a molecular weight of 229.15 g/mol, XLogP of -0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate is sourced from PubChem (CID 58448718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).