C9H18N2O4 — CID 59740172
ethyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-hydroxypropanoate (PubChem CID 59740172) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 59740172 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](CO)NC(=O)C(C)(C)N |
| InChI | InChI=1S/C9H18N2O4/c1-4-15-7(13)6(5-12)11-8(14)9(2,3)10/h6,12H,4-5,10H2,1-3H3,(H,11,14)/t6-/m0/s1 |
| InChIKey | VYJBZZSYNISBBX-LURJTMIESA-N |
| XLogP | -1.24 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |