C12H22N2O6 — CID 72570963
ethyl 2-amino-5-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)amino]-5-oxopentanoate (PubChem CID 72570963) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 2-amino-5-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)amino]-5-oxopentanoate.
| Compound Name | ethyl 2-amino-5-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 72570963 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl 2-amino-5-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)amino]-5-oxopentanoate |
| SMILES | CCOC(=O)C(N)CCC(=O)NC(CO)C(=O)OCC |
| InChI | InChI=1S/C12H22N2O6/c1-3-19-11(17)8(13)5-6-10(16)14-9(7-15)12(18)20-4-2/h8-9,15H,3-7,13H2,1-2H3,(H,14,16) |
| InChIKey | ZZFBQEBKSJBKKK-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |