C23H39N3O10 — CID 86178402
diethyl 2-[[4-amino-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate (PubChem CID 86178402) has the molecular formula C23H39N3O10 and a molecular weight of 517.58 g/mol. Its IUPAC name is diethyl 2-[[4-amino-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-amino-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 86178402 |
| Molecular Formula | C23H39N3O10 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | diethyl 2-[[4-amino-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)CCC(N)C(=O)NC(CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H39N3O10/c1-5-33-19(28)13-10-16(22(31)35-7-3)25-18(27)12-9-15(24)21(30)26-17(23(32)36-8-4)11-14-20(29)34-6-2/h15-17H,5-14,24H2,1-4H3,(H,25,27)(H,26,30) |
| InChIKey | RWILEZDVCZCUFP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 189.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|