C20H33N3O10 — CID 101451173
diethyl (2S)-2-[[(3S)-3-amino-4-[[(2S)-1,4-diethoxy-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]butanedioate (PubChem CID 101451173) has the molecular formula C20H33N3O10 and a molecular weight of 475.50 g/mol. Its IUPAC name is diethyl (2S)-2-[[(3S)-3-amino-4-[[(2S)-1,4-diethoxy-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]butanedioate.
| Compound Name | diethyl (2S)-2-[[(3S)-3-amino-4-[[(2S)-1,4-diethoxy-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 101451173 |
| Molecular Formula | C20H33N3O10 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | diethyl (2S)-2-[[(3S)-3-amino-4-[[(2S)-1,4-diethoxy-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]butanedioate |
| SMILES | CCOC(=O)C[C@H](NC(=O)C[C@H](N)C(=O)N[C@@H](CC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H33N3O10/c1-5-30-16(25)10-13(19(28)32-7-3)22-15(24)9-12(21)18(27)23-14(20(29)33-8-4)11-17(26)31-6-2/h12-14H,5-11,21H2,1-4H3,(H,22,24)(H,23,27)/t12-,13-,14-/m0/s1 |
| InChIKey | QUFINWVXLVFJBN-IHRRRGAJSA-N |
| XLogP | -1.29 |
| TPSA | 189.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|