C12H21NO5 — CID 59038083
diethyl (2S)-2-(2-methylpropanoylamino)butanedioate (PubChem CID 59038083) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is diethyl (2S)-2-(2-methylpropanoylamino)butanedioate.
| Compound Name | diethyl (2S)-2-(2-methylpropanoylamino)butanedioate |
|---|---|
| PubChem CID | 59038083 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | diethyl (2S)-2-(2-methylpropanoylamino)butanedioate |
| SMILES | CCOC(=O)C[C@H](NC(=O)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C12H21NO5/c1-5-17-10(14)7-9(12(16)18-6-2)13-11(15)8(3)4/h8-9H,5-7H2,1-4H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | YQHMKORNODOQSN-VIFPVBQESA-N |
| XLogP | 0.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |