About ethyl 2-methylpropanoate;2-methylpropanehydrazide
ethyl 2-methylpropanoate;2-methylpropanehydrazide (PubChem CID 159155209) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethyl 2-methylpropanoate;2-methylpropanehydrazide.
Molecular Properties
| Compound Name | ethyl 2-methylpropanoate;2-methylpropanehydrazide |
| PubChem CID | 159155209 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | ethyl 2-methylpropanoate;2-methylpropanehydrazide |
| SMILES | CC(C)C(=O)NN.CCOC(=O)C(C)C |
| InChI | InChI=1S/C6H12O2.C4H10N2O/c1-4-8-6(7)5(2)3;1-3(2)4(7)6-5/h5H,4H2,1-3H3;3H,5H2,1-2H3,(H,6,7) |
| InChIKey | KJUNKVCYZDFEBR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylpropanoate;2-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylpropanoate;2-methylpropanehydrazide?
The IUPAC name of ethyl 2-methylpropanoate;2-methylpropanehydrazide (CID 159155209) is ethyl 2-methylpropanoate;2-methylpropanehydrazide.
What is the SMILES notation for ethyl 2-methylpropanoate;2-methylpropanehydrazide?
The canonical SMILES for ethyl 2-methylpropanoate;2-methylpropanehydrazide is CC(C)C(=O)NN.CCOC(=O)C(C)C.
What is the InChIKey of ethyl 2-methylpropanoate;2-methylpropanehydrazide?
The InChIKey is KJUNKVCYZDFEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H10N2O/c1-4-8-6(7)5(2)3;1-3(2)4(7)6-5/h5H,4H2,1-3H3;3H,5H2,1-2H3,(H,6,7).
What are the key properties of ethyl 2-methylpropanoate;2-methylpropanehydrazide?
ethyl 2-methylpropanoate;2-methylpropanehydrazide has a molecular weight of 218.30 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylpropanoate;2-methylpropanehydrazide is sourced from PubChem (CID 159155209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).