C13H27NO4 — CID 158222142
N-(2-hydroxyethyl)-2-methylpropanamide;propyl 2-methylpropanoate (PubChem CID 158222142) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-methylpropanamide;propyl 2-methylpropanoate.
| Compound Name | N-(2-hydroxyethyl)-2-methylpropanamide;propyl 2-methylpropanoate |
|---|---|
| PubChem CID | 158222142 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(2-hydroxyethyl)-2-methylpropanamide;propyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)NCCO.CCCOC(=O)C(C)C |
| InChI | InChI=1S/C7H14O2.C6H13NO2/c1-4-5-9-7(8)6(2)3;1-5(2)6(9)7-3-4-8/h6H,4-5H2,1-3H3;5,8H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | GDJDOYDCQZIYFF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |