About 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine
2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine (PubChem CID 164972287) has the molecular formula C8H21N3O2
and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine.
Molecular Properties
| Compound Name | 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine |
| PubChem CID | 164972287 |
| Molecular Formula | C8H21N3O2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.16 |
| IUPAC Name | 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine |
| SMILES | CC(C)C(=O)NN.CC(C)CON |
| InChI | InChI=1S/C4H10N2O.C4H11NO/c1-3(2)4(7)6-5;1-4(2)3-6-5/h3H,5H2,1-2H3,(H,6,7);4H,3,5H2,1-2H3 |
| InChIKey | DHFGKLYVDDVLSU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine?
The IUPAC name of 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine (CID 164972287) is 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine.
What is the SMILES notation for 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine?
The canonical SMILES for 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine is CC(C)C(=O)NN.CC(C)CON.
What is the InChIKey of 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine?
The InChIKey is DHFGKLYVDDVLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.C4H11NO/c1-3(2)4(7)6-5;1-4(2)3-6-5/h3H,5H2,1-2H3,(H,6,7);4H,3,5H2,1-2H3.
What are the key properties of 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine?
2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine has a molecular weight of 191.28 g/mol, XLogP of 0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanehydrazide;O-(2-methylpropyl)hydroxylamine is sourced from PubChem (CID 164972287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).