About 2-methylpropyl N-hydroxycarbamate
2-methylpropyl N-hydroxycarbamate (PubChem CID 22467) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-methylpropyl N-hydroxycarbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-hydroxycarbamate |
| PubChem CID | 22467 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 2-methylpropyl N-hydroxycarbamate |
| SMILES | CC(C)COC(=O)NO |
| InChI | InChI=1S/C5H11NO3/c1-4(2)3-9-5(7)6-8/h4,8H,3H2,1-2H3,(H,6,7) |
| InChIKey | ITJIAVPHDOKGHM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-hydroxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-hydroxycarbamate?
The IUPAC name of 2-methylpropyl N-hydroxycarbamate (CID 22467) is 2-methylpropyl N-hydroxycarbamate.
What is the SMILES notation for 2-methylpropyl N-hydroxycarbamate?
The canonical SMILES for 2-methylpropyl N-hydroxycarbamate is CC(C)COC(=O)NO.
What is the InChIKey of 2-methylpropyl N-hydroxycarbamate?
The InChIKey is ITJIAVPHDOKGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-4(2)3-9-5(7)6-8/h4,8H,3H2,1-2H3,(H,6,7).
What are the key properties of 2-methylpropyl N-hydroxycarbamate?
2-methylpropyl N-hydroxycarbamate has a molecular weight of 133.15 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-hydroxycarbamate is sourced from PubChem (CID 22467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).