About 2-methylpropyl N-(2-hydroxypropyl)carbamate
2-methylpropyl N-(2-hydroxypropyl)carbamate (PubChem CID 43427881) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-methylpropyl N-(2-hydroxypropyl)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-(2-hydroxypropyl)carbamate |
| PubChem CID | 43427881 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-methylpropyl N-(2-hydroxypropyl)carbamate |
| SMILES | CC(C)COC(=O)NCC(C)O |
| InChI | InChI=1S/C8H17NO3/c1-6(2)5-12-8(11)9-4-7(3)10/h6-7,10H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | HKFRMOBXGKARTH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl N-(2-hydroxypropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(2-hydroxypropyl)carbamate?
The IUPAC name of 2-methylpropyl N-(2-hydroxypropyl)carbamate (CID 43427881) is 2-methylpropyl N-(2-hydroxypropyl)carbamate.
What is the SMILES notation for 2-methylpropyl N-(2-hydroxypropyl)carbamate?
The canonical SMILES for 2-methylpropyl N-(2-hydroxypropyl)carbamate is CC(C)COC(=O)NCC(C)O.
What is the InChIKey of 2-methylpropyl N-(2-hydroxypropyl)carbamate?
The InChIKey is HKFRMOBXGKARTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-6(2)5-12-8(11)9-4-7(3)10/h6-7,10H,4-5H2,1-3H3,(H,9,11).
What are the key properties of 2-methylpropyl N-(2-hydroxypropyl)carbamate?
2-methylpropyl N-(2-hydroxypropyl)carbamate has a molecular weight of 175.23 g/mol, XLogP of 0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(2-hydroxypropyl)carbamate is sourced from PubChem (CID 43427881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).