C16H32N2O4 — CID 91749295
2-methylpropyl N-[6-(2-methylpropoxycarbonylamino)hexyl]carbamate (PubChem CID 91749295) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-methylpropyl N-[6-(2-methylpropoxycarbonylamino)hexyl]carbamate.
| Compound Name | 2-methylpropyl N-[6-(2-methylpropoxycarbonylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 91749295 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-methylpropyl N-[6-(2-methylpropoxycarbonylamino)hexyl]carbamate |
| SMILES | CC(C)COC(=O)NCCCCCCNC(=O)OCC(C)C |
| InChI | InChI=1S/C16H32N2O4/c1-13(2)11-21-15(19)17-9-7-5-6-8-10-18-16(20)22-12-14(3)4/h13-14H,5-12H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | TWGHOHVZYIUFEM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|