About 2-iodopropyl N-butylcarbamate
2-iodopropyl N-butylcarbamate (PubChem CID 175153431) has the molecular formula C8H16INO2
and a molecular weight of 285.13 g/mol. Its IUPAC name is 2-iodopropyl N-butylcarbamate.
Molecular Properties
| Compound Name | 2-iodopropyl N-butylcarbamate |
| PubChem CID | 175153431 |
| Molecular Formula | C8H16INO2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-iodopropyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC(C)I |
| InChI | InChI=1S/C8H16INO2/c1-3-4-5-10-8(11)12-6-7(2)9/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | UINSQXHAGXKZRQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodopropyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodopropyl N-butylcarbamate?
The IUPAC name of 2-iodopropyl N-butylcarbamate (CID 175153431) is 2-iodopropyl N-butylcarbamate.
What is the SMILES notation for 2-iodopropyl N-butylcarbamate?
The canonical SMILES for 2-iodopropyl N-butylcarbamate is CCCCNC(=O)OCC(C)I.
What is the InChIKey of 2-iodopropyl N-butylcarbamate?
The InChIKey is UINSQXHAGXKZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16INO2/c1-3-4-5-10-8(11)12-6-7(2)9/h7H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 2-iodopropyl N-butylcarbamate?
2-iodopropyl N-butylcarbamate has a molecular weight of 285.13 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodopropyl N-butylcarbamate is sourced from PubChem (CID 175153431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).