About 2-(propylamino)ethyl N-butylcarbamate
2-(propylamino)ethyl N-butylcarbamate (PubChem CID 79338122) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(propylamino)ethyl N-butylcarbamate.
Molecular Properties
| Compound Name | 2-(propylamino)ethyl N-butylcarbamate |
| PubChem CID | 79338122 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-(propylamino)ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCCNCCC |
| InChI | InChI=1S/C10H22N2O2/c1-3-5-7-12-10(13)14-9-8-11-6-4-2/h11H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | VVAUURKDPPANMP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(propylamino)ethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)ethyl N-butylcarbamate?
The IUPAC name of 2-(propylamino)ethyl N-butylcarbamate (CID 79338122) is 2-(propylamino)ethyl N-butylcarbamate.
What is the SMILES notation for 2-(propylamino)ethyl N-butylcarbamate?
The canonical SMILES for 2-(propylamino)ethyl N-butylcarbamate is CCCCNC(=O)OCCNCCC.
What is the InChIKey of 2-(propylamino)ethyl N-butylcarbamate?
The InChIKey is VVAUURKDPPANMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-3-5-7-12-10(13)14-9-8-11-6-4-2/h11H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 2-(propylamino)ethyl N-butylcarbamate?
2-(propylamino)ethyl N-butylcarbamate has a molecular weight of 202.30 g/mol, XLogP of 1.51, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)ethyl N-butylcarbamate is sourced from PubChem (CID 79338122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).