About ethane;2-(heptylamino)ethyl N-butylcarbamate
ethane;2-(heptylamino)ethyl N-butylcarbamate (PubChem CID 144831677) has the molecular formula C16H36N2O2
and a molecular weight of 288.48 g/mol. Its IUPAC name is ethane;2-(heptylamino)ethyl N-butylcarbamate.
Molecular Properties
| Compound Name | ethane;2-(heptylamino)ethyl N-butylcarbamate |
| PubChem CID | 144831677 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | ethane;2-(heptylamino)ethyl N-butylcarbamate |
| SMILES | CC.CCCCCCCNCCOC(=O)NCCCC |
| InChI | InChI=1S/C14H30N2O2.C2H6/c1-3-5-7-8-9-10-15-12-13-18-14(17)16-11-6-4-2;1-2/h15H,3-13H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | NDMDOCPJWPZHJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(heptylamino)ethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(heptylamino)ethyl N-butylcarbamate?
The IUPAC name of ethane;2-(heptylamino)ethyl N-butylcarbamate (CID 144831677) is ethane;2-(heptylamino)ethyl N-butylcarbamate.
What is the SMILES notation for ethane;2-(heptylamino)ethyl N-butylcarbamate?
The canonical SMILES for ethane;2-(heptylamino)ethyl N-butylcarbamate is CC.CCCCCCCNCCOC(=O)NCCCC.
What is the InChIKey of ethane;2-(heptylamino)ethyl N-butylcarbamate?
The InChIKey is NDMDOCPJWPZHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2.C2H6/c1-3-5-7-8-9-10-15-12-13-18-14(17)16-11-6-4-2;1-2/h15H,3-13H2,1-2H3,(H,16,17);1-2H3.
What are the key properties of ethane;2-(heptylamino)ethyl N-butylcarbamate?
ethane;2-(heptylamino)ethyl N-butylcarbamate has a molecular weight of 288.48 g/mol, XLogP of 4.10, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(heptylamino)ethyl N-butylcarbamate is sourced from PubChem (CID 144831677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).