About azane;octyl N-octylcarbamate
azane;octyl N-octylcarbamate (PubChem CID 175531380) has the molecular formula C17H38N2O2
and a molecular weight of 302.50 g/mol. Its IUPAC name is azane;octyl N-octylcarbamate.
Molecular Properties
| Compound Name | azane;octyl N-octylcarbamate |
| PubChem CID | 175531380 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | azane;octyl N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OCCCCCCCC.N |
| InChI | InChI=1S/C17H35NO2.H3N/c1-3-5-7-9-11-13-15-18-17(19)20-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,18,19);1H3 |
| InChIKey | BKTIWEYDTZCION-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;octyl N-octylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;octyl N-octylcarbamate?
The IUPAC name of azane;octyl N-octylcarbamate (CID 175531380) is azane;octyl N-octylcarbamate.
What is the SMILES notation for azane;octyl N-octylcarbamate?
The canonical SMILES for azane;octyl N-octylcarbamate is CCCCCCCCNC(=O)OCCCCCCCC.N.
What is the InChIKey of azane;octyl N-octylcarbamate?
The InChIKey is BKTIWEYDTZCION-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2.H3N/c1-3-5-7-9-11-13-15-18-17(19)20-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,18,19);1H3.
What are the key properties of azane;octyl N-octylcarbamate?
azane;octyl N-octylcarbamate has a molecular weight of 302.50 g/mol, XLogP of 5.60, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;octyl N-octylcarbamate is sourced from PubChem (CID 175531380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).