About 2-fluoroethyl N-hexylcarbamate
2-fluoroethyl N-hexylcarbamate (PubChem CID 87287131) has the molecular formula C9H18FNO2
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-fluoroethyl N-hexylcarbamate.
Molecular Properties
| Compound Name | 2-fluoroethyl N-hexylcarbamate |
| PubChem CID | 87287131 |
| Molecular Formula | C9H18FNO2 |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-fluoroethyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OCCF |
| InChI | InChI=1S/C9H18FNO2/c1-2-3-4-5-7-11-9(12)13-8-6-10/h2-8H2,1H3,(H,11,12) |
| InChIKey | DKIGUQNLGZIBLN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl N-hexylcarbamate?
The IUPAC name of 2-fluoroethyl N-hexylcarbamate (CID 87287131) is 2-fluoroethyl N-hexylcarbamate.
What is the SMILES notation for 2-fluoroethyl N-hexylcarbamate?
The canonical SMILES for 2-fluoroethyl N-hexylcarbamate is CCCCCCNC(=O)OCCF.
What is the InChIKey of 2-fluoroethyl N-hexylcarbamate?
The InChIKey is DKIGUQNLGZIBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNO2/c1-2-3-4-5-7-11-9(12)13-8-6-10/h2-8H2,1H3,(H,11,12).
What are the key properties of 2-fluoroethyl N-hexylcarbamate?
2-fluoroethyl N-hexylcarbamate has a molecular weight of 191.25 g/mol, XLogP of 2.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl N-hexylcarbamate is sourced from PubChem (CID 87287131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).