C26H44N2O4 — CID 102402136
12-(hexylcarbamoyloxy)dodeca-5,7-diynyl N-hexylcarbamate (PubChem CID 102402136) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is 12-(hexylcarbamoyloxy)dodeca-5,7-diynyl N-hexylcarbamate.
| Compound Name | 12-(hexylcarbamoyloxy)dodeca-5,7-diynyl N-hexylcarbamate |
|---|---|
| PubChem CID | 102402136 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 12-(hexylcarbamoyloxy)dodeca-5,7-diynyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OCCCCC#CC#CCCCCOC(=O)NCCCCCC |
| InChI | InChI=1S/C26H44N2O4/c1-3-5-7-17-21-27-25(29)31-23-19-15-13-11-9-10-12-14-16-20-24-32-26(30)28-22-18-8-6-4-2/h3-8,13-24H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | ULPUMYOAOQUGDP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|