C28H48N2O4 — CID 102402143
12-(heptylcarbamoyloxy)dodeca-5,7-diynyl N-heptylcarbamate (PubChem CID 102402143) has the molecular formula C28H48N2O4 and a molecular weight of 476.70 g/mol. Its IUPAC name is 12-(heptylcarbamoyloxy)dodeca-5,7-diynyl N-heptylcarbamate.
| Compound Name | 12-(heptylcarbamoyloxy)dodeca-5,7-diynyl N-heptylcarbamate |
|---|---|
| PubChem CID | 102402143 |
| Molecular Formula | C28H48N2O4 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.36 |
| IUPAC Name | 12-(heptylcarbamoyloxy)dodeca-5,7-diynyl N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)OCCCCC#CC#CCCCCOC(=O)NCCCCCCC |
| InChI | InChI=1S/C28H48N2O4/c1-3-5-7-15-19-23-29-27(31)33-25-21-17-13-11-9-10-12-14-18-22-26-34-28(32)30-24-20-16-8-6-4-2/h3-8,13-26H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | IQMOLSFOLWBFDC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|