About 2-methylbutyl N-propylcarbamate
2-methylbutyl N-propylcarbamate (PubChem CID 127538020) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methylbutyl N-propylcarbamate.
Molecular Properties
| Compound Name | 2-methylbutyl N-propylcarbamate |
| PubChem CID | 127538020 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-methylbutyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCC(C)CC |
| InChI | InChI=1S/C9H19NO2/c1-4-6-10-9(11)12-7-8(3)5-2/h8H,4-7H2,1-3H3,(H,10,11) |
| InChIKey | VUUSAKHTMZJGCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl N-propylcarbamate?
The IUPAC name of 2-methylbutyl N-propylcarbamate (CID 127538020) is 2-methylbutyl N-propylcarbamate.
What is the SMILES notation for 2-methylbutyl N-propylcarbamate?
The canonical SMILES for 2-methylbutyl N-propylcarbamate is CCCNC(=O)OCC(C)CC.
What is the InChIKey of 2-methylbutyl N-propylcarbamate?
The InChIKey is VUUSAKHTMZJGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-6-10-9(11)12-7-8(3)5-2/h8H,4-7H2,1-3H3,(H,10,11).
What are the key properties of 2-methylbutyl N-propylcarbamate?
2-methylbutyl N-propylcarbamate has a molecular weight of 173.26 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl N-propylcarbamate is sourced from PubChem (CID 127538020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).