About 2-hydroxyethyl N-propylcarbamate
2-hydroxyethyl N-propylcarbamate (PubChem CID 15560805) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 2-hydroxyethyl N-propylcarbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-propylcarbamate |
| PubChem CID | 15560805 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2-hydroxyethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCCO |
| InChI | InChI=1S/C6H13NO3/c1-2-3-7-6(9)10-5-4-8/h8H,2-5H2,1H3,(H,7,9) |
| InChIKey | MMMVQHZWYQYOIX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-propylcarbamate?
The IUPAC name of 2-hydroxyethyl N-propylcarbamate (CID 15560805) is 2-hydroxyethyl N-propylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-propylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-propylcarbamate is CCCNC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-propylcarbamate?
The InChIKey is MMMVQHZWYQYOIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-2-3-7-6(9)10-5-4-8/h8H,2-5H2,1H3,(H,7,9).
What are the key properties of 2-hydroxyethyl N-propylcarbamate?
2-hydroxyethyl N-propylcarbamate has a molecular weight of 147.17 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-propylcarbamate is sourced from PubChem (CID 15560805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).