C8H17NO5 — CID 79348554
2-hydroxyethyl N-[2-(2-methoxyethoxy)ethyl]carbamate (PubChem CID 79348554) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-hydroxyethyl N-[2-(2-methoxyethoxy)ethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[2-(2-methoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 79348554 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-hydroxyethyl N-[2-(2-methoxyethoxy)ethyl]carbamate |
| SMILES | COCCOCCNC(=O)OCCO |
| InChI | InChI=1S/C8H17NO5/c1-12-6-7-13-4-2-9-8(11)14-5-3-10/h10H,2-7H2,1H3,(H,9,11) |
| InChIKey | XGPZYMMYOAONKO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|