C25H51NO13 — CID 87060453
9-hydroperoxyperoxynonyl N-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 87060453) has the molecular formula C25H51NO13 and a molecular weight of 573.68 g/mol. Its IUPAC name is 9-hydroperoxyperoxynonyl N-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 9-hydroperoxyperoxynonyl N-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 87060453 |
| Molecular Formula | C25H51NO13 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | 9-hydroperoxyperoxynonyl N-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCNC(=O)OCCCCCCCCCOOOO |
| InChI | InChI=1S/C25H51NO13/c1-29-13-14-31-17-18-33-21-22-35-24-23-34-20-19-32-16-15-30-12-9-26-25(27)36-10-7-5-3-2-4-6-8-11-37-39-38-28/h28H,2-24H2,1H3,(H,26,27) |
| InChIKey | VGJDMBSQXPCQDO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|