C14H26N4O9 — CID 19751998
3-[2-[2-[3-(carboxyamino)propoxycarbonylamino]ethoxy]ethylcarbamoyloxy]propylcarbamic acid (PubChem CID 19751998) has the molecular formula C14H26N4O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-[2-[2-[3-(carboxyamino)propoxycarbonylamino]ethoxy]ethylcarbamoyloxy]propylcarbamic acid.
| Compound Name | 3-[2-[2-[3-(carboxyamino)propoxycarbonylamino]ethoxy]ethylcarbamoyloxy]propylcarbamic acid |
|---|---|
| PubChem CID | 19751998 |
| Molecular Formula | C14H26N4O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[2-[2-[3-(carboxyamino)propoxycarbonylamino]ethoxy]ethylcarbamoyloxy]propylcarbamic acid |
| SMILES | O=C(O)NCCCOC(=O)NCCOCCNC(=O)OCCCNC(=O)O |
| InChI | InChI=1S/C14H26N4O9/c19-11(20)15-3-1-7-26-13(23)17-5-9-25-10-6-18-14(24)27-8-2-4-16-12(21)22/h15-16H,1-10H2,(H,17,23)(H,18,24)(H,19,20)(H,21,22) |
| InChIKey | RJNUTXWSCNAJLF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 184.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|