C17H37N3O8 — CID 88542577
2-[2-[3-[2-(2-aminoethoxy)ethoxy]-2-[2-(2-aminoethoxy)ethoxymethyl]propoxy]ethoxy]ethylcarbamic acid (PubChem CID 88542577) has the molecular formula C17H37N3O8 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[2-[3-[2-(2-aminoethoxy)ethoxy]-2-[2-(2-aminoethoxy)ethoxymethyl]propoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[3-[2-(2-aminoethoxy)ethoxy]-2-[2-(2-aminoethoxy)ethoxymethyl]propoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 88542577 |
| Molecular Formula | C17H37N3O8 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[2-[3-[2-(2-aminoethoxy)ethoxy]-2-[2-(2-aminoethoxy)ethoxymethyl]propoxy]ethoxy]ethylcarbamic acid |
| SMILES | NCCOCCOCC(COCCOCCN)COCCOCCNC(=O)O |
| InChI | InChI=1S/C17H37N3O8/c18-1-4-23-7-10-26-13-16(14-27-11-8-24-5-2-19)15-28-12-9-25-6-3-20-17(21)22/h16,20H,1-15,18-19H2,(H,21,22) |
| InChIKey | AIZYRJQPEQGBMO-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 156.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|