C5H12N2O3S — CID 135336731
2-(2-amino-2-sulfanylethoxy)ethylcarbamic acid (PubChem CID 135336731) has the molecular formula C5H12N2O3S and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-(2-amino-2-sulfanylethoxy)ethylcarbamic acid.
| Compound Name | 2-(2-amino-2-sulfanylethoxy)ethylcarbamic acid |
|---|---|
| PubChem CID | 135336731 |
| Molecular Formula | C5H12N2O3S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-(2-amino-2-sulfanylethoxy)ethylcarbamic acid |
| SMILES | NC(S)COCCNC(=O)O |
| InChI | InChI=1S/C5H12N2O3S/c6-4(11)3-10-2-1-7-5(8)9/h4,7,11H,1-3,6H2,(H,8,9) |
| InChIKey | SJACOMQGXUYFSG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|