C12H26N4O4 — CID 15459454
(2S)-2-amino-N-[2-[2-[2-[[(2S)-2-aminopropanoyl]amino]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 15459454) has the molecular formula C12H26N4O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[2-[2-[[(2S)-2-aminopropanoyl]amino]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-[2-[2-[[(2S)-2-aminopropanoyl]amino]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 15459454 |
| Molecular Formula | C12H26N4O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2S)-2-amino-N-[2-[2-[2-[[(2S)-2-aminopropanoyl]amino]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | C[C@H](N)C(=O)NCCOCCOCCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C12H26N4O4/c1-9(13)11(17)15-3-5-19-7-8-20-6-4-16-12(18)10(2)14/h9-10H,3-8,13-14H2,1-2H3,(H,15,17)(H,16,18)/t9-,10-/m0/s1 |
| InChIKey | BSWIKDVPHLMOQD-UWVGGRQHSA-N |
| XLogP | -2.05 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|