C6H14N2O2 — CID 24703832
2-amino-N-(2-methoxyethyl)propanamide (PubChem CID 24703832) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-amino-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 24703832 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)N |
| InChI | InChI=1S/C6H14N2O2/c1-5(7)6(9)8-3-4-10-2/h5H,3-4,7H2,1-2H3,(H,8,9) |
| InChIKey | GKJVURZPTBIILI-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|