C16H35N3O6 — CID 156530272
N-[2-[2-[2-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-methylpropanamide (PubChem CID 156530272) has the molecular formula C16H35N3O6 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 156530272 |
| Molecular Formula | C16H35N3O6 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCOCCOCCOCCOCCOCCNN |
| InChI | InChI=1S/C16H35N3O6/c1-15(2)16(20)18-3-5-21-7-9-23-11-13-25-14-12-24-10-8-22-6-4-19-17/h15,19H,3-14,17H2,1-2H3,(H,18,20) |
| InChIKey | YZPFXDJOJXALDB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|