C15H31N3O4 — CID 138727149
2-methyl-N-[2-[2-[2-(2-methylpropylcarbamoylamino)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 138727149) has the molecular formula C15H31N3O4 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-(2-methylpropylcarbamoylamino)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-(2-methylpropylcarbamoylamino)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 138727149 |
| Molecular Formula | C15H31N3O4 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-(2-methylpropylcarbamoylamino)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)CNC(=O)NCCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C15H31N3O4/c1-12(2)11-18-15(20)17-6-8-22-10-9-21-7-5-16-14(19)13(3)4/h12-13H,5-11H2,1-4H3,(H,16,19)(H2,17,18,20) |
| InChIKey | ZLWNZKAQHMTYTC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|