C13H28N2O2 — CID 164775026
1-[2-(3,3-dimethylbutoxy)ethyl]-3-(2-methylpropyl)urea (PubChem CID 164775026) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbutoxy)ethyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 164775026 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)NCCOCCC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-11(2)10-15-12(16)14-7-9-17-8-6-13(3,4)5/h11H,6-10H2,1-5H3,(H2,14,15,16) |
| InChIKey | WHDJHLCIPUVGKC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|