C9H15F3N2O4 — CID 63834426
2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid (PubChem CID 63834426) has the molecular formula C9H15F3N2O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid.
| Compound Name | 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 63834426 |
| Molecular Formula | C9H15F3N2O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]propanoic acid |
| SMILES | CC(CNC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3N2O4/c1-6(7(15)16)4-14-8(17)13-2-3-18-5-9(10,11)12/h6H,2-5H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | GKOQULGQTRIORE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|