C11H21F3N2O3 — CID 87034535
1-[2-(2-methylpropoxy)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 87034535) has the molecular formula C11H21F3N2O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-[2-(2-methylpropoxy)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 1-[2-(2-methylpropoxy)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 87034535 |
| Molecular Formula | C11H21F3N2O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[2-(2-methylpropoxy)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | CC(C)COCCNC(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O3/c1-9(2)7-18-5-3-15-10(17)16-4-6-19-8-11(12,13)14/h9H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | BKZJLUBSXUJPMI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|