C7H10F6N2O2 — CID 113223589
1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113223589) has the molecular formula C7H10F6N2O2 and a molecular weight of 268.16 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113223589 |
| Molecular Formula | C7H10F6N2O2 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCOCC(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C7H10F6N2O2/c8-6(9,10)3-15-5(16)14-1-2-17-4-7(11,12)13/h1-4H2,(H2,14,15,16) |
| InChIKey | SDANCDCSLJBLTI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|