C6H8F6N2O — CID 115662977
1-(2,2,2-trifluoroethyl)-3-(3,3,3-trifluoropropyl)urea (PubChem CID 115662977) has the molecular formula C6H8F6N2O and a molecular weight of 238.13 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 115662977 |
| Molecular Formula | C6H8F6N2O |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C6H8F6N2O/c7-5(8,9)1-2-13-4(15)14-3-6(10,11)12/h1-3H2,(H2,13,14,15) |
| InChIKey | WYVXVECVPLFIRY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |