C8H12F6N2O — CID 115758261
1-(2,2,2-trifluoroethyl)-3-(5,5,5-trifluoropentyl)urea (PubChem CID 115758261) has the molecular formula C8H12F6N2O and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-(5,5,5-trifluoropentyl)urea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-(5,5,5-trifluoropentyl)urea |
|---|---|
| PubChem CID | 115758261 |
| Molecular Formula | C8H12F6N2O |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-(5,5,5-trifluoropentyl)urea |
| SMILES | O=C(NCCCCC(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C8H12F6N2O/c9-7(10,11)3-1-2-4-15-6(17)16-5-8(12,13)14/h1-5H2,(H2,15,16,17) |
| InChIKey | AZBBYRUFNRMQNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|