C11H19F3N2O3 — CID 115521411
4-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid (PubChem CID 115521411) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid.
| Compound Name | 4-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 115521411 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-8(4-5-9(17)18)16-10(19)15-7-3-2-6-11(12,13)14/h8H,2-7H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | SMBJKJXTDWSFCP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|