C11H19F3N2O3S — CID 115521482
4-methylsulfanyl-2-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid (PubChem CID 115521482) has the molecular formula C11H19F3N2O3S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid.
| Compound Name | 4-methylsulfanyl-2-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 115521482 |
| Molecular Formula | C11H19F3N2O3S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-methylsulfanyl-2-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid |
| SMILES | CSCCC(NC(=O)NCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H19F3N2O3S/c1-20-7-4-8(9(17)18)16-10(19)15-6-3-2-5-11(12,13)14/h8H,2-7H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | VXDGXUUCQCBPNH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|