C7H11F3N2O3 — CID 63227638
3-(3,3,3-trifluoropropylcarbamoylamino)propanoic acid (PubChem CID 63227638) has the molecular formula C7H11F3N2O3 and a molecular weight of 228.17 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropylcarbamoylamino)propanoic acid.
| Compound Name | 3-(3,3,3-trifluoropropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 63227638 |
| Molecular Formula | C7H11F3N2O3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(3,3,3-trifluoropropylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O3/c8-7(9,10)2-4-12-6(15)11-3-1-5(13)14/h1-4H2,(H,13,14)(H2,11,12,15) |
| InChIKey | OQYRJCBMUWHSJL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |